C24H20ClN3O6S — CID 4011581
[2-chloro-4-[(5-imino-2-methyl-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 3,4-dimethoxybenzoate (PubChem CID 4011581) has the molecular formula C24H20ClN3O6S and a molecular weight of 513.96 g/mol. Its IUPAC name is [2-chloro-4-[(5-imino-2-methyl-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-chloro-4-[(5-imino-2-methyl-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 4011581 |
| Molecular Formula | C24H20ClN3O6S |
| Molecular Weight | 513.96 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | [2-chloro-4-[(5-imino-2-methyl-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 3,4-dimethoxybenzoate |
| SMILES | [H]/N=C1\C(=Cc2cc(Cl)c(OC(=O)c3ccc(OC)c(OC)c3)c(OC)c2)C(=O)N=C2SC(C)=CN21 |
| InChI | InChI=1S/C24H20ClN3O6S/c1-12-11-28-21(26)15(22(29)27-24(28)35-12)7-13-8-16(25)20(19(9-13)33-4)34-23(30)14-5-6-17(31-2)18(10-14)32-3/h5-11,26H,1-4H3/b15-7?,26-21+ |
| InChIKey | LGFCXOFOICPWBV-UHNMRJHDSA-N |
| XLogP | 4.75 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.96 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|