C28H19Cl2N3O5S — CID 3495950
[2-chloro-4-[[3-(2-chlorophenyl)-5-imino-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 3495950) has the molecular formula C28H19Cl2N3O5S and a molecular weight of 580.45 g/mol. Its IUPAC name is [2-chloro-4-[[3-(2-chlorophenyl)-5-imino-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-chloro-4-[[3-(2-chlorophenyl)-5-imino-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 3495950 |
| Molecular Formula | C28H19Cl2N3O5S |
| Molecular Weight | 580.45 g/mol |
| Exact Mass | 579.04 |
| IUPAC Name | [2-chloro-4-[[3-(2-chlorophenyl)-5-imino-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | [H]/N=C1\C(=Cc2ccc(OC(=O)c3ccc(OC)c(OC)c3)c(Cl)c2)C(=O)N=C2SC=C(c3ccccc3Cl)N21 |
| InChI | InChI=1S/C28H19Cl2N3O5S/c1-36-23-10-8-16(13-24(23)37-2)27(35)38-22-9-7-15(12-20(22)30)11-18-25(31)33-21(14-39-28(33)32-26(18)34)17-5-3-4-6-19(17)29/h3-14,31H,1-2H3/b18-11?,31-25+ |
| InChIKey | HJYPPGPYAODLDI-HILPIDQTSA-N |
| XLogP | 6.53 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.45 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|