C22H16N4O3S — CID 3472770
2-[4-[(5-imino-7-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenoxy]acetonitrile (PubChem CID 3472770) has the molecular formula C22H16N4O3S and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-[4-[(5-imino-7-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-[(5-imino-7-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 3472770 |
| Molecular Formula | C22H16N4O3S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-[4-[(5-imino-7-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenoxy]acetonitrile |
| SMILES | [H]/N=C1\C(=Cc2ccc(OCC#N)c(OC)c2)C(=O)N=C2SC=C(c3ccccc3)N21 |
| InChI | InChI=1S/C22H16N4O3S/c1-28-19-12-14(7-8-18(19)29-10-9-23)11-16-20(24)26-17(15-5-3-2-4-6-15)13-30-22(26)25-21(16)27/h2-8,11-13,24H,10H2,1H3/b16-11?,24-20+ |
| InChIKey | MSCZYFGSRQIPTM-KBZBGNJJSA-N |
| XLogP | 3.90 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|