C29H25N3O3S — CID 3491261
6-[[3-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3491261) has the molecular formula C29H25N3O3S and a molecular weight of 495.60 g/mol. Its IUPAC name is 6-[[3-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[3-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3491261 |
| Molecular Formula | C29H25N3O3S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 6-[[3-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cccc(OCCOc3cc(C)cc(C)c3)c2)C(=O)N=C2SC=C(c3ccccc3)N21 |
| InChI | InChI=1S/C29H25N3O3S/c1-19-13-20(2)15-24(14-19)35-12-11-34-23-10-6-7-21(16-23)17-25-27(30)32-26(22-8-4-3-5-9-22)18-36-29(32)31-28(25)33/h3-10,13-18,30H,11-12H2,1-2H3/b25-17?,30-27+ |
| InChIKey | FNTSNJDPKWUZSD-GNCHEUOMSA-N |
| XLogP | 6.07 |
| TPSA | 74.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|