C28H23N3O3S — CID 4271769
5-imino-6-[[4-(3-phenoxypropoxy)phenyl]methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4271769) has the molecular formula C28H23N3O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is 5-imino-6-[[4-(3-phenoxypropoxy)phenyl]methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 5-imino-6-[[4-(3-phenoxypropoxy)phenyl]methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4271769 |
| Molecular Formula | C28H23N3O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 5-imino-6-[[4-(3-phenoxypropoxy)phenyl]methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(OCCCOc3ccccc3)cc2)C(=O)N=C2SC=C(c3ccccc3)N21 |
| InChI | InChI=1S/C28H23N3O3S/c29-26-24(27(32)30-28-31(26)25(19-35-28)21-8-3-1-4-9-21)18-20-12-14-23(15-13-20)34-17-7-16-33-22-10-5-2-6-11-22/h1-6,8-15,18-19,29H,7,16-17H2/b24-18?,29-26+ |
| InChIKey | FTPPVEWSWYQFGC-BJXCUCSYSA-N |
| XLogP | 5.84 |
| TPSA | 74.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|