C27H21N3O6S2 — CID 3816685
[4-[(5-imino-7-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenyl] 4-methoxybenzenesulfonate (PubChem CID 3816685) has the molecular formula C27H21N3O6S2 and a molecular weight of 547.61 g/mol. Its IUPAC name is [4-[(5-imino-7-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenyl] 4-methoxybenzenesulfonate.
| Compound Name | [4-[(5-imino-7-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 3816685 |
| Molecular Formula | C27H21N3O6S2 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | [4-[(5-imino-7-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenyl] 4-methoxybenzenesulfonate |
| SMILES | [H]/N=C1\C(=Cc2ccc(OS(=O)(=O)c3ccc(OC)cc3)c(OC)c2)C(=O)N=C2SC=C(c3ccccc3)N21 |
| InChI | InChI=1S/C27H21N3O6S2/c1-34-19-9-11-20(12-10-19)38(32,33)36-23-13-8-17(15-24(23)35-2)14-21-25(28)30-22(18-6-4-3-5-7-18)16-37-27(30)29-26(21)31/h3-16,28H,1-2H3/b21-14?,28-25+ |
| InChIKey | XFSHKUFEVLZZEH-WHZITVEYSA-N |
| XLogP | 4.78 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|