C29H24ClN3O4S — CID 3426036
6-[[4-[3-(4-chlorophenoxy)propoxy]-3-methoxyphenyl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3426036) has the molecular formula C29H24ClN3O4S and a molecular weight of 546.05 g/mol. Its IUPAC name is 6-[[4-[3-(4-chlorophenoxy)propoxy]-3-methoxyphenyl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[4-[3-(4-chlorophenoxy)propoxy]-3-methoxyphenyl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3426036 |
| Molecular Formula | C29H24ClN3O4S |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 6-[[4-[3-(4-chlorophenoxy)propoxy]-3-methoxyphenyl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(OCCCOc3ccc(Cl)cc3)c(OC)c2)C(=O)N=C2SC=C(c3ccccc3)N21 |
| InChI | InChI=1S/C29H24ClN3O4S/c1-35-26-17-19(8-13-25(26)37-15-5-14-36-22-11-9-21(30)10-12-22)16-23-27(31)33-24(20-6-3-2-4-7-20)18-38-29(33)32-28(23)34/h2-4,6-13,16-18,31H,5,14-15H2,1H3/b23-16?,31-27+ |
| InChIKey | RLHRWIMJCUFLSY-POMFCMIXSA-N |
| XLogP | 6.50 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|