C28H22N4O5S — CID 3337234
6-[[3-ethoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3337234) has the molecular formula C28H22N4O5S and a molecular weight of 526.57 g/mol. Its IUPAC name is 6-[[3-ethoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[3-ethoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3337234 |
| Molecular Formula | C28H22N4O5S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 6-[[3-ethoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(OCc3ccccc3[N+](=O)[O-])c(OCC)c2)C(=O)N=C2SC=C(c3ccccc3)N21 |
| InChI | InChI=1S/C28H22N4O5S/c1-2-36-25-15-18(12-13-24(25)37-16-20-10-6-7-11-22(20)32(34)35)14-21-26(29)31-23(19-8-4-3-5-9-19)17-38-28(31)30-27(21)33/h3-15,17,29H,2,16H2,1H3/b21-14?,29-26+ |
| InChIKey | VZXFAHIYWORMBI-UAGYTEBTSA-N |
| XLogP | 5.88 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|