C24H15ClN6O4S — CID 3727687
6-[[3-chloro-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3727687) has the molecular formula C24H15ClN6O4S and a molecular weight of 518.94 g/mol. Its IUPAC name is 6-[[3-chloro-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[3-chloro-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3727687 |
| Molecular Formula | C24H15ClN6O4S |
| Molecular Weight | 518.94 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | 6-[[3-chloro-4-[(2-nitrophenyl)methoxy]phenyl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(OCc3ccccc3[N+](=O)[O-])c(Cl)c2)C(=O)N=C2SC(c3cccnc3)=NN21 |
| InChI | InChI=1S/C24H15ClN6O4S/c25-18-11-14(7-8-20(18)35-13-16-4-1-2-6-19(16)31(33)34)10-17-21(26)30-24(28-22(17)32)36-23(29-30)15-5-3-9-27-12-15/h1-12,26H,13H2/b17-10?,26-21+ |
| InChIKey | IISLVVDVMMINHG-BAKLKUPCSA-N |
| XLogP | 4.89 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.94 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|