C21H15ClN4O5S2 — CID 46251798
[2-chloro-4-[(Z)-(5-imino-3-methylsulfonyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methylbenzoate (PubChem CID 46251798) has the molecular formula C21H15ClN4O5S2 and a molecular weight of 502.96 g/mol. Its IUPAC name is [2-chloro-4-[(Z)-(5-imino-3-methylsulfonyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methylbenzoate.
| Compound Name | [2-chloro-4-[(Z)-(5-imino-3-methylsulfonyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 46251798 |
| Molecular Formula | C21H15ClN4O5S2 |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | [2-chloro-4-[(Z)-(5-imino-3-methylsulfonyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methylbenzoate |
| SMILES | [H]/N=C1C(=C\c2ccc(OC(=O)c3cccc(C)c3)c(Cl)c2)\C(=O)N=C2SN=C(S(C)(=O)=O)N2\1 |
| InChI | InChI=1S/C21H15ClN4O5S2/c1-11-4-3-5-13(8-11)19(28)31-16-7-6-12(10-15(16)22)9-14-17(23)26-20(24-18(14)27)32-25-21(26)33(2,29)30/h3-10,23H,1-2H3/b14-9-,23-17+ |
| InChIKey | YADOJHFTSKVTEO-JVMJTSHDSA-N |
| XLogP | 3.49 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|