C20H13FN4O5S2 — CID 46251771
[4-[(Z)-(5-imino-3-methylsulfonyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 2-fluorobenzoate (PubChem CID 46251771) has the molecular formula C20H13FN4O5S2 and a molecular weight of 472.48 g/mol. Its IUPAC name is [4-[(Z)-(5-imino-3-methylsulfonyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 2-fluorobenzoate.
| Compound Name | [4-[(Z)-(5-imino-3-methylsulfonyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 46251771 |
| Molecular Formula | C20H13FN4O5S2 |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | [4-[(Z)-(5-imino-3-methylsulfonyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 2-fluorobenzoate |
| SMILES | [H]/N=C1C(=C\c2ccc(OC(=O)c3ccccc3F)cc2)\C(=O)N=C2SN=C(S(C)(=O)=O)N2\1 |
| InChI | InChI=1S/C20H13FN4O5S2/c1-32(28,29)20-24-31-19-23-17(26)14(16(22)25(19)20)10-11-6-8-12(9-7-11)30-18(27)13-4-2-3-5-15(13)21/h2-10,22H,1H3/b14-10-,22-16+ |
| InChIKey | WKHUESDUSWTLIW-NDWUGUBKSA-N |
| XLogP | 2.67 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|