C20H12FN3O3S — CID 1295913
[4-[(Z)-(5-imino-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 2-fluorobenzoate (PubChem CID 1295913) has the molecular formula C20H12FN3O3S and a molecular weight of 393.40 g/mol. Its IUPAC name is [4-[(Z)-(5-imino-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 2-fluorobenzoate.
| Compound Name | [4-[(Z)-(5-imino-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 1295913 |
| Molecular Formula | C20H12FN3O3S |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | [4-[(Z)-(5-imino-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 2-fluorobenzoate |
| SMILES | [H]/N=C1C(=C/c2ccc(OC(=O)c3ccccc3F)cc2)/C(=O)N=C2SC=CN2/1 |
| InChI | InChI=1S/C20H12FN3O3S/c21-16-4-2-1-3-14(16)19(26)27-13-7-5-12(6-8-13)11-15-17(22)24-9-10-28-20(24)23-18(15)25/h1-11,22H/b15-11-,22-17- |
| InChIKey | QPSYKSOQYUOYTQ-ALNLXFQPSA-N |
| XLogP | 3.82 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|