C23H13ClN4O4S — CID 2181149
[4-[(E)-[2-(furan-2-yl)-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 2181149) has the molecular formula C23H13ClN4O4S and a molecular weight of 476.90 g/mol. Its IUPAC name is [4-[(E)-[2-(furan-2-yl)-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-[(E)-[2-(furan-2-yl)-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 2181149 |
| Molecular Formula | C23H13ClN4O4S |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | [4-[(E)-[2-(furan-2-yl)-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | [H]/N=C1C(=C\c2ccc(OC(=O)c3ccccc3Cl)cc2)/C(=O)N=C2SC(c3ccco3)=NN2/1 |
| InChI | InChI=1S/C23H13ClN4O4S/c24-17-5-2-1-4-15(17)22(30)32-14-9-7-13(8-10-14)12-16-19(25)28-23(26-20(16)29)33-21(27-28)18-6-3-11-31-18/h1-12,25H/b16-12+,25-19- |
| InChIKey | XGGQEEHDQVQJOQ-DHFYGYITSA-N |
| XLogP | 4.82 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|