C22H16ClN5O2S — CID 3725016
6-[[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(furan-2-yl)-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3725016) has the molecular formula C22H16ClN5O2S and a molecular weight of 449.92 g/mol. Its IUPAC name is 6-[[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(furan-2-yl)-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(furan-2-yl)-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3725016 |
| Molecular Formula | C22H16ClN5O2S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 6-[[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(furan-2-yl)-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2cc(C)n(-c3ccccc3Cl)c2C)C(=O)N=C2SC(c3ccco3)=NN21 |
| InChI | InChI=1S/C22H16ClN5O2S/c1-12-10-14(13(2)27(12)17-7-4-3-6-16(17)23)11-15-19(24)28-22(25-20(15)29)31-21(26-28)18-8-5-9-30-18/h3-11,24H,1-2H3/b15-11?,24-19- |
| InChIKey | KPVOQMXNAJFQPD-UKULYQJPSA-N |
| XLogP | 5.01 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|