C23H16Cl2N6OS — CID 2048216
(6E)-6-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 2048216) has the molecular formula C23H16Cl2N6OS and a molecular weight of 495.40 g/mol. Its IUPAC name is (6E)-6-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-6-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 2048216 |
| Molecular Formula | C23H16Cl2N6OS |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | (6E)-6-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cc(C)n(-c3ccc(Cl)cc3Cl)c2C)/C(=O)N=C2SC(c3cccnc3)=NN2/1 |
| InChI | InChI=1S/C23H16Cl2N6OS/c1-12-8-15(13(2)30(12)19-6-5-16(24)10-18(19)25)9-17-20(26)31-23(28-21(17)32)33-22(29-31)14-4-3-7-27-11-14/h3-11,26H,1-2H3/b17-9+,26-20- |
| InChIKey | NYGCYTJAFCVCAM-XOKDJILNSA-N |
| XLogP | 5.46 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|