C24H20N6OS — CID 4652914
6-[[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4652914) has the molecular formula C24H20N6OS and a molecular weight of 440.53 g/mol. Its IUPAC name is 6-[[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4652914 |
| Molecular Formula | C24H20N6OS |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 6-[[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2cc(C)n(-c3ccccc3C)c2C)C(=O)N=C2SC(c3cccnc3)=NN21 |
| InChI | InChI=1S/C24H20N6OS/c1-14-7-4-5-9-20(14)29-15(2)11-18(16(29)3)12-19-21(25)30-24(27-22(19)31)32-23(28-30)17-8-6-10-26-13-17/h4-13,25H,1-3H3/b19-12?,25-21- |
| InChIKey | MNZJHZKSMOLEKQ-WKTCKKPUSA-N |
| XLogP | 4.47 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|