C25H22N6OS — CID 3285265
6-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3285265) has the molecular formula C25H22N6OS and a molecular weight of 454.56 g/mol. Its IUPAC name is 6-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3285265 |
| Molecular Formula | C25H22N6OS |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 6-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2cc(C)n(-c3ccccc3CC)c2C)C(=O)N=C2SC(c3cccnc3)=NN21 |
| InChI | InChI=1S/C25H22N6OS/c1-4-17-8-5-6-10-21(17)30-15(2)12-19(16(30)3)13-20-22(26)31-25(28-23(20)32)33-24(29-31)18-9-7-11-27-14-18/h5-14,26H,4H2,1-3H3/b20-13?,26-22- |
| InChIKey | VJDZQRNGHCPJMO-ISIJKBPZSA-N |
| XLogP | 4.72 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|