C27H33N5OS — CID 3889120
6-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3889120) has the molecular formula C27H33N5OS and a molecular weight of 475.66 g/mol. Its IUPAC name is 6-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3889120 |
| Molecular Formula | C27H33N5OS |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 6-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2cc(C)n(-c3ccccc3CC)c2C)C(=O)N=C2SC(CCCCCCC)=NN21 |
| InChI | InChI=1S/C27H33N5OS/c1-5-7-8-9-10-15-24-30-32-25(28)22(26(33)29-27(32)34-24)17-21-16-18(3)31(19(21)4)23-14-12-11-13-20(23)6-2/h11-14,16-17,28H,5-10,15H2,1-4H3/b22-17?,28-25- |
| InChIKey | GHISXYXACKJION-AJVXLDSSSA-N |
| XLogP | 6.64 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|