C26H30ClN5OS — CID 56727880
(6Z)-6-[[1-(2-chloro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 56727880) has the molecular formula C26H30ClN5OS and a molecular weight of 496.08 g/mol. Its IUPAC name is (6Z)-6-[[1-(2-chloro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[1-(2-chloro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56727880 |
| Molecular Formula | C26H30ClN5OS |
| Molecular Weight | 496.08 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | (6Z)-6-[[1-(2-chloro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cc(C)n(-c3ccc(C)cc3Cl)c2C)/C(=O)N=C2SC(CCCCCCC)=NN2/1 |
| InChI | InChI=1S/C26H30ClN5OS/c1-5-6-7-8-9-10-23-30-32-24(28)20(25(33)29-26(32)34-23)15-19-14-17(3)31(18(19)4)22-12-11-16(2)13-21(22)27/h11-15,28H,5-10H2,1-4H3/b20-15-,28-24- |
| InChIKey | BUEYEDXFYOSQIB-VOGYXHDRSA-N |
| XLogP | 7.04 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.08 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|