C21H11ClN6O2S2 — CID 4887665
6-[[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylidene]-2-(furan-2-yl)-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4887665) has the molecular formula C21H11ClN6O2S2 and a molecular weight of 478.95 g/mol. Its IUPAC name is 6-[[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylidene]-2-(furan-2-yl)-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylidene]-2-(furan-2-yl)-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4887665 |
| Molecular Formula | C21H11ClN6O2S2 |
| Molecular Weight | 478.95 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | 6-[[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylidene]-2-(furan-2-yl)-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2c(-c3ccc(Cl)cc3)nc3sccn23)C(=O)N=C2SC(c3ccco3)=NN21 |
| InChI | InChI=1S/C21H11ClN6O2S2/c22-12-5-3-11(4-6-12)16-14(27-7-9-31-20(27)24-16)10-13-17(23)28-21(25-18(13)29)32-19(26-28)15-2-1-8-30-15/h1-10,23H/b13-10?,23-17- |
| InChIKey | IZAHFNJRWJTRLM-WUUGLUFFSA-N |
| XLogP | 4.98 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.95 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|