C14H8N4OS3 — CID 2177608
(6Z)-5-imino-2-thiophen-2-yl-6-(thiophen-2-ylmethylidene)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 2177608) has the molecular formula C14H8N4OS3 and a molecular weight of 344.45 g/mol. Its IUPAC name is (6Z)-5-imino-2-thiophen-2-yl-6-(thiophen-2-ylmethylidene)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-5-imino-2-thiophen-2-yl-6-(thiophen-2-ylmethylidene)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 2177608 |
| Molecular Formula | C14H8N4OS3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | (6Z)-5-imino-2-thiophen-2-yl-6-(thiophen-2-ylmethylidene)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cccs2)/C(=O)N=C2SC(c3cccs3)=NN2/1 |
| InChI | InChI=1S/C14H8N4OS3/c15-11-9(7-8-3-1-5-20-8)12(19)16-14-18(11)17-13(22-14)10-4-2-6-21-10/h1-7,15H/b9-7-,15-11- |
| InChIKey | LLVPHKJAAZXBFS-ZXNRLBBPSA-N |
| XLogP | 3.48 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|