C19H13ClN4OS — CID 4219591
2-(2-chlorophenyl)-5-imino-6-[(3-methylphenyl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4219591) has the molecular formula C19H13ClN4OS and a molecular weight of 380.86 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5-imino-6-[(3-methylphenyl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 2-(2-chlorophenyl)-5-imino-6-[(3-methylphenyl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4219591 |
| Molecular Formula | C19H13ClN4OS |
| Molecular Weight | 380.86 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-(2-chlorophenyl)-5-imino-6-[(3-methylphenyl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cccc(C)c2)C(=O)N=C2SC(c3ccccc3Cl)=NN21 |
| InChI | InChI=1S/C19H13ClN4OS/c1-11-5-4-6-12(9-11)10-14-16(21)24-19(22-17(14)25)26-18(23-24)13-7-2-3-8-15(13)20/h2-10,21H,1H3/b14-10?,21-16+ |
| InChIKey | XCTYRXTVYWELCH-PHLOYADUSA-N |
| XLogP | 4.32 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.86 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|