C30H28Cl2N4O3S — CID 171151028
2-(2-chlorophenyl)-5-imino-6-[[3-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]phenyl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one;hydrochloride (PubChem CID 171151028) has the molecular formula C30H28Cl2N4O3S and a molecular weight of 595.55 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5-imino-6-[[3-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]phenyl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one;hydrochloride.
| Compound Name | 2-(2-chlorophenyl)-5-imino-6-[[3-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]phenyl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one;hydrochloride |
|---|---|
| PubChem CID | 171151028 |
| Molecular Formula | C30H28Cl2N4O3S |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | 2-(2-chlorophenyl)-5-imino-6-[[3-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]phenyl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one;hydrochloride |
| SMILES | Cl.[H]/N=C1\C(=Cc2cccc(OCCOc3cc(C)ccc3C(C)C)c2)C(=O)N=C2SC(c3ccccc3Cl)=NN21 |
| InChI | InChI=1S/C30H27ClN4O3S.ClH/c1-18(2)22-12-11-19(3)15-26(22)38-14-13-37-21-8-6-7-20(16-21)17-24-27(32)35-30(33-28(24)36)39-29(34-35)23-9-4-5-10-25(23)31;/h4-12,15-18,32H,13-14H2,1-3H3;1H/b24-17?,32-27+; |
| InChIKey | KJECZTLICSSSMM-AJTAXMLBSA-N |
| XLogP | 7.32 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|