C20H14N4O3S — CID 2301065
(6Z)-6-(1,3-benzodioxol-5-ylmethylidene)-5-imino-2-(3-methylphenyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 2301065) has the molecular formula C20H14N4O3S and a molecular weight of 390.42 g/mol. Its IUPAC name is (6Z)-6-(1,3-benzodioxol-5-ylmethylidene)-5-imino-2-(3-methylphenyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-(1,3-benzodioxol-5-ylmethylidene)-5-imino-2-(3-methylphenyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 2301065 |
| Molecular Formula | C20H14N4O3S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (6Z)-6-(1,3-benzodioxol-5-ylmethylidene)-5-imino-2-(3-methylphenyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccc3c(c2)OCO3)/C(=O)N=C2SC(c3cccc(C)c3)=NN2/1 |
| InChI | InChI=1S/C20H14N4O3S/c1-11-3-2-4-13(7-11)19-23-24-17(21)14(18(25)22-20(24)28-19)8-12-5-6-15-16(9-12)27-10-26-15/h2-9,21H,10H2,1H3/b14-8-,21-17- |
| InChIKey | CKNXMZQVRYGIAT-OHTZJGCRSA-N |
| XLogP | 3.39 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|