C22H18N4O5S — CID 4563917
6-(1,3-benzodioxol-5-ylmethylidene)-2-[(3,4-dimethoxyphenyl)methyl]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4563917) has the molecular formula C22H18N4O5S and a molecular weight of 450.48 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethylidene)-2-[(3,4-dimethoxyphenyl)methyl]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethylidene)-2-[(3,4-dimethoxyphenyl)methyl]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4563917 |
| Molecular Formula | C22H18N4O5S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethylidene)-2-[(3,4-dimethoxyphenyl)methyl]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc3c(c2)OCO3)C(=O)N=C2SC(Cc3ccc(OC)c(OC)c3)=NN21 |
| InChI | InChI=1S/C22H18N4O5S/c1-28-15-5-3-13(8-17(15)29-2)10-19-25-26-20(23)14(21(27)24-22(26)32-19)7-12-4-6-16-18(9-12)31-11-30-16/h3-9,23H,10-11H2,1-2H3/b14-7?,23-20+ |
| InChIKey | YFIOUVYNTGPHKA-YHNINIMBSA-N |
| XLogP | 3.29 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|