C25H19FN4O4S — CID 3436056
2-[(3,4-dimethoxyphenyl)methyl]-6-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3436056) has the molecular formula C25H19FN4O4S and a molecular weight of 490.52 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-6-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-6-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3436056 |
| Molecular Formula | C25H19FN4O4S |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-6-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(-c3ccc(F)cc3)o2)C(=O)N=C2SC(Cc3ccc(OC)c(OC)c3)=NN21 |
| InChI | InChI=1S/C25H19FN4O4S/c1-32-20-9-3-14(11-21(20)33-2)12-22-29-30-23(27)18(24(31)28-25(30)35-22)13-17-8-10-19(34-17)15-4-6-16(26)7-5-15/h3-11,13,27H,12H2,1-2H3/b18-13?,27-23+ |
| InChIKey | HMIOKVUJHILPRM-DWXTZXKOSA-N |
| XLogP | 4.96 |
| TPSA | 100.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|