C25H18N4O5S — CID 4018072
4-[5-[[5-imino-2-[(3-methylphenoxy)methyl]-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 4018072) has the molecular formula C25H18N4O5S and a molecular weight of 486.51 g/mol. Its IUPAC name is 4-[5-[[5-imino-2-[(3-methylphenoxy)methyl]-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[[5-imino-2-[(3-methylphenoxy)methyl]-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4018072 |
| Molecular Formula | C25H18N4O5S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 4-[5-[[5-imino-2-[(3-methylphenoxy)methyl]-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | [H]/N=C1\C(=Cc2ccc(-c3ccc(C(=O)O)cc3)o2)C(=O)N=C2SC(COc3cccc(C)c3)=NN21 |
| InChI | InChI=1S/C25H18N4O5S/c1-14-3-2-4-17(11-14)33-13-21-28-29-22(26)19(23(30)27-25(29)35-21)12-18-9-10-20(34-18)15-5-7-16(8-6-15)24(31)32/h2-12,26H,13H2,1H3,(H,31,32)/b19-12?,26-22+ |
| InChIKey | SNNNOSJMEFMQQP-HUSVWTDCSA-N |
| XLogP | 4.65 |
| TPSA | 128.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|