C23H13N4O4S- — CID 2277532
4-[5-[(Z)-(5-imino-7-oxo-2-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 2277532) has the molecular formula C23H13N4O4S- and a molecular weight of 441.45 g/mol. Its IUPAC name is 4-[5-[(Z)-(5-imino-7-oxo-2-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 4-[5-[(Z)-(5-imino-7-oxo-2-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2277532 |
| Molecular Formula | C23H13N4O4S- |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 4-[5-[(Z)-(5-imino-7-oxo-2-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | [H]/N=C1C(=C/c2ccc(-c3ccc(C(=O)[O-])cc3)o2)/C(=O)N=C2SC(c3ccccc3)=NN2/1 |
| InChI | InChI=1S/C23H14N4O4S/c24-19-17(12-16-10-11-18(31-16)13-6-8-15(9-7-13)22(29)30)20(28)25-23-27(19)26-21(32-23)14-4-2-1-3-5-14/h1-12,24H,(H,29,30)/p-1/b17-12-,24-19- |
| InChIKey | KDLXIVDOPBICPN-DGCGOETISA-M |
| XLogP | 2.98 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|