C17H8ClF3N4O2S — CID 1337161
6-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-5-imino-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 1337161) has the molecular formula C17H8ClF3N4O2S and a molecular weight of 424.79 g/mol. Its IUPAC name is 6-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-5-imino-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-5-imino-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 1337161 |
| Molecular Formula | C17H8ClF3N4O2S |
| Molecular Weight | 424.79 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 6-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-5-imino-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(-c3ccc(Cl)cc3)o2)C(=O)N=C2SC(C(F)(F)F)=NN21 |
| InChI | InChI=1S/C17H8ClF3N4O2S/c18-9-3-1-8(2-4-9)12-6-5-10(27-12)7-11-13(22)25-16(23-14(11)26)28-15(24-25)17(19,20)21/h1-7,22H/b11-7?,22-13+ |
| InChIKey | IYNIQBKQSSSGTI-YLRDGDONSA-N |
| XLogP | 4.78 |
| TPSA | 82.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.79 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|