C19H11F3N4O4S — CID 46498772
methyl 2-[5-[(Z)-[5-imino-7-oxo-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 46498772) has the molecular formula C19H11F3N4O4S and a molecular weight of 448.38 g/mol. Its IUPAC name is methyl 2-[5-[(Z)-[5-imino-7-oxo-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(Z)-[5-imino-7-oxo-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 46498772 |
| Molecular Formula | C19H11F3N4O4S |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | methyl 2-[5-[(Z)-[5-imino-7-oxo-2-(trifluoromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | [H]/N=C1C(=C/c2ccc(-c3ccccc3C(=O)OC)o2)/C(=O)N=C2SC(C(F)(F)F)=NN2/1 |
| InChI | InChI=1S/C19H11F3N4O4S/c1-29-16(28)11-5-3-2-4-10(11)13-7-6-9(30-13)8-12-14(23)26-18(24-15(12)27)31-17(25-26)19(20,21)22/h2-8,23H,1H3/b12-8-,23-14- |
| InChIKey | HNGFJBDYGMUWTC-PLJZRZRTSA-N |
| XLogP | 3.91 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|