C22H20N4O4S — CID 46499025
methyl 2-[5-[(Z)-[5-imino-2-(2-methylpropyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 46499025) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is methyl 2-[5-[(Z)-[5-imino-2-(2-methylpropyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(Z)-[5-imino-2-(2-methylpropyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 46499025 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | methyl 2-[5-[(Z)-[5-imino-2-(2-methylpropyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | [H]/N=C1C(=C/c2ccc(-c3ccccc3C(=O)OC)o2)/C(=O)N=C2SC(CC(C)C)=NN2/1 |
| InChI | InChI=1S/C22H20N4O4S/c1-12(2)10-18-25-26-19(23)16(20(27)24-22(26)31-18)11-13-8-9-17(30-13)14-6-4-5-7-15(14)21(28)29-3/h4-9,11-12,23H,10H2,1-3H3/b16-11-,23-19- |
| InChIKey | DDHWCUMSZNCEME-QUCAZCOOSA-N |
| XLogP | 4.40 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|