C25H17ClN4O4S — CID 3420592
ethyl 4-[5-[[2-(2-chlorophenyl)-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 3420592) has the molecular formula C25H17ClN4O4S and a molecular weight of 504.96 g/mol. Its IUPAC name is ethyl 4-[5-[[2-(2-chlorophenyl)-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[[2-(2-chlorophenyl)-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 3420592 |
| Molecular Formula | C25H17ClN4O4S |
| Molecular Weight | 504.96 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | ethyl 4-[5-[[2-(2-chlorophenyl)-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | [H]/N=C1\C(=Cc2ccc(-c3ccc(C(=O)OCC)cc3)o2)C(=O)N=C2SC(c3ccccc3Cl)=NN21 |
| InChI | InChI=1S/C25H17ClN4O4S/c1-2-33-24(32)15-9-7-14(8-10-15)20-12-11-16(34-20)13-18-21(27)30-25(28-22(18)31)35-23(29-30)17-5-3-4-6-19(17)26/h3-13,27H,2H2,1H3/b18-13?,27-21+ |
| InChIKey | LNCVTMKEKDVOAN-VIXUAEMYSA-N |
| XLogP | 5.44 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.96 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|