C26H25N5O5S — CID 4307092
ethyl 3-[5-[[5-imino-7-oxo-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 4307092) has the molecular formula C26H25N5O5S and a molecular weight of 519.58 g/mol. Its IUPAC name is ethyl 3-[5-[[5-imino-7-oxo-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 3-[5-[[5-imino-7-oxo-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 4307092 |
| Molecular Formula | C26H25N5O5S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | ethyl 3-[5-[[5-imino-7-oxo-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | [H]/N=C1\C(=Cc2ccc(-c3cccc(C(=O)OCC)c3)o2)C(=O)N=C2SC(CC(=O)N3CCCCC3)=NN21 |
| InChI | InChI=1S/C26H25N5O5S/c1-2-35-25(34)17-8-6-7-16(13-17)20-10-9-18(36-20)14-19-23(27)31-26(28-24(19)33)37-21(29-31)15-22(32)30-11-4-3-5-12-30/h6-10,13-14,27H,2-5,11-12,15H2,1H3/b19-14?,27-23+ |
| InChIKey | UPVMOPVAJAMHQP-LNHPTWQVSA-N |
| XLogP | 4.15 |
| TPSA | 128.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|