C23H20BrN5O3S — CID 3822764
6-[[5-(4-bromophenyl)furan-2-yl]methylidene]-5-imino-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3822764) has the molecular formula C23H20BrN5O3S and a molecular weight of 526.42 g/mol. Its IUPAC name is 6-[[5-(4-bromophenyl)furan-2-yl]methylidene]-5-imino-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[5-(4-bromophenyl)furan-2-yl]methylidene]-5-imino-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3822764 |
| Molecular Formula | C23H20BrN5O3S |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | 6-[[5-(4-bromophenyl)furan-2-yl]methylidene]-5-imino-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(-c3ccc(Br)cc3)o2)C(=O)N=C2SC(CC(=O)N3CCCCC3)=NN21 |
| InChI | InChI=1S/C23H20BrN5O3S/c24-15-6-4-14(5-7-15)18-9-8-16(32-18)12-17-21(25)29-23(26-22(17)31)33-19(27-29)13-20(30)28-10-2-1-3-11-28/h4-9,12,25H,1-3,10-11,13H2/b17-12?,25-21+ |
| InChIKey | YSEUMRYVLHJCQC-PDCZUXSISA-N |
| XLogP | 4.73 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|