C21H23BrN6O2S — CID 3844259
6-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-5-imino-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3844259) has the molecular formula C21H23BrN6O2S and a molecular weight of 503.43 g/mol. Its IUPAC name is 6-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-5-imino-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-5-imino-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3844259 |
| Molecular Formula | C21H23BrN6O2S |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 6-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-5-imino-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(N(C)C)c(Br)c2)C(=O)N=C2SC(CC(=O)N3CCCCC3)=NN21 |
| InChI | InChI=1S/C21H23BrN6O2S/c1-26(2)16-7-6-13(11-15(16)22)10-14-19(23)28-21(24-20(14)30)31-17(25-28)12-18(29)27-8-4-3-5-9-27/h6-7,10-11,23H,3-5,8-9,12H2,1-2H3/b14-10?,23-19+ |
| InChIKey | XWGKLORHPMURKM-NKVOQCRTSA-N |
| XLogP | 3.54 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|