C18H19BrN6O2S — CID 46260131
(6E)-6-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-5-imino-2-morpholin-4-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46260131) has the molecular formula C18H19BrN6O2S and a molecular weight of 463.36 g/mol. Its IUPAC name is (6E)-6-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-5-imino-2-morpholin-4-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-6-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-5-imino-2-morpholin-4-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46260131 |
| Molecular Formula | C18H19BrN6O2S |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | (6E)-6-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-5-imino-2-morpholin-4-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2ccc(N(C)C)c(Br)c2)/C(=O)N=C2SC(N3CCOCC3)=NN2/1 |
| InChI | InChI=1S/C18H19BrN6O2S/c1-23(2)14-4-3-11(10-13(14)19)9-12-15(20)25-17(21-16(12)26)28-18(22-25)24-5-7-27-8-6-24/h3-4,9-10,20H,5-8H2,1-2H3/b12-9+,20-15- |
| InChIKey | HQXBZNCQXWLFFZ-RGRQOOPWSA-N |
| XLogP | 2.42 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|