C24H21N5O4S — CID 46259967
(6E)-6-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-5-imino-2-pyrrolidin-1-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46259967) has the molecular formula C24H21N5O4S and a molecular weight of 475.53 g/mol. Its IUPAC name is (6E)-6-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-5-imino-2-pyrrolidin-1-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-6-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-5-imino-2-pyrrolidin-1-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46259967 |
| Molecular Formula | C24H21N5O4S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (6E)-6-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-5-imino-2-pyrrolidin-1-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2ccc(OCc3ccc4c(c3)OCO4)cc2)/C(=O)N=C2SC(N3CCCC3)=NN2/1 |
| InChI | InChI=1S/C24H21N5O4S/c25-21-18(22(30)26-23-29(21)27-24(34-23)28-9-1-2-10-28)11-15-3-6-17(7-4-15)31-13-16-5-8-19-20(12-16)33-14-32-19/h3-8,11-12,25H,1-2,9-10,13-14H2/b18-11+,25-21- |
| InChIKey | NVSXHBRQCWARPH-ONZUJUEZSA-N |
| XLogP | 3.67 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|