C20H21BrN6O3S — CID 3697057
6-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3697057) has the molecular formula C20H21BrN6O3S and a molecular weight of 505.40 g/mol. Its IUPAC name is 6-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3697057 |
| Molecular Formula | C20H21BrN6O3S |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 6-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(N(C)C)c(Br)c2)C(=O)N=C2SC(CC(=O)N3CCOCC3)=NN21 |
| InChI | InChI=1S/C20H21BrN6O3S/c1-25(2)15-4-3-12(10-14(15)21)9-13-18(22)27-20(23-19(13)29)31-16(24-27)11-17(28)26-5-7-30-8-6-26/h3-4,9-10,22H,5-8,11H2,1-2H3/b13-9?,22-18+ |
| InChIKey | MIPOILFRNBXDTH-ODIUEAFJSA-N |
| XLogP | 2.38 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|