C21H23N5O6S — CID 3624500
5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-6-[(3,4,5-trimethoxyphenyl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3624500) has the molecular formula C21H23N5O6S and a molecular weight of 473.51 g/mol. Its IUPAC name is 5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-6-[(3,4,5-trimethoxyphenyl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-6-[(3,4,5-trimethoxyphenyl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3624500 |
| Molecular Formula | C21H23N5O6S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-6-[(3,4,5-trimethoxyphenyl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cc(OC)c(OC)c(OC)c2)C(=O)N=C2SC(CC(=O)N3CCOCC3)=NN21 |
| InChI | InChI=1S/C21H23N5O6S/c1-29-14-9-12(10-15(30-2)18(14)31-3)8-13-19(22)26-21(23-20(13)28)33-16(24-26)11-17(27)25-4-6-32-7-5-25/h8-10,22H,4-7,11H2,1-3H3/b13-8?,22-19+ |
| InChIKey | DNTQQRFQPDPWNB-OWHLGPIJSA-N |
| XLogP | 1.58 |
| TPSA | 126.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|