C23H21N5O5S — CID 4894223
5-imino-6-[(7-methoxy-4-oxochromen-3-yl)methylidene]-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4894223) has the molecular formula C23H21N5O5S and a molecular weight of 479.52 g/mol. Its IUPAC name is 5-imino-6-[(7-methoxy-4-oxochromen-3-yl)methylidene]-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 5-imino-6-[(7-methoxy-4-oxochromen-3-yl)methylidene]-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4894223 |
| Molecular Formula | C23H21N5O5S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 5-imino-6-[(7-methoxy-4-oxochromen-3-yl)methylidene]-2-(2-oxo-2-piperidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2coc3cc(OC)ccc3c2=O)C(=O)N=C2SC(CC(=O)N3CCCCC3)=NN21 |
| InChI | InChI=1S/C23H21N5O5S/c1-32-14-5-6-15-17(10-14)33-12-13(20(15)30)9-16-21(24)28-23(25-22(16)31)34-18(26-28)11-19(29)27-7-3-2-4-8-27/h5-6,9-10,12,24H,2-4,7-8,11H2,1H3/b16-9?,24-21- |
| InChIKey | UXYKSVAELIKVDR-ZAPFRZSISA-N |
| XLogP | 2.82 |
| TPSA | 128.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|