C28H26N6O2S — CID 3754905
5-imino-6-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]-2-(2-oxo-2-pyrrolidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3754905) has the molecular formula C28H26N6O2S and a molecular weight of 510.62 g/mol. Its IUPAC name is 5-imino-6-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]-2-(2-oxo-2-pyrrolidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 5-imino-6-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]-2-(2-oxo-2-pyrrolidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3754905 |
| Molecular Formula | C28H26N6O2S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 5-imino-6-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]-2-(2-oxo-2-pyrrolidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2cn(Cc3cccc(C)c3)c3ccccc23)C(=O)N=C2SC(CC(=O)N3CCCC3)=NN21 |
| InChI | InChI=1S/C28H26N6O2S/c1-18-7-6-8-19(13-18)16-33-17-20(21-9-2-3-10-23(21)33)14-22-26(29)34-28(30-27(22)36)37-24(31-34)15-25(35)32-11-4-5-12-32/h2-3,6-10,13-14,17,29H,4-5,11-12,15-16H2,1H3/b22-14?,29-26- |
| InChIKey | LOXSXAUUNKXYPN-VQRJWBDZSA-N |
| XLogP | 4.63 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|