C29H23N5O2S — CID 6518015
(6Z)-6-[(1-benzylindol-3-yl)methylidene]-5-imino-2-[(2-methylphenoxy)methyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 6518015) has the molecular formula C29H23N5O2S and a molecular weight of 505.60 g/mol. Its IUPAC name is (6Z)-6-[(1-benzylindol-3-yl)methylidene]-5-imino-2-[(2-methylphenoxy)methyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[(1-benzylindol-3-yl)methylidene]-5-imino-2-[(2-methylphenoxy)methyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 6518015 |
| Molecular Formula | C29H23N5O2S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | (6Z)-6-[(1-benzylindol-3-yl)methylidene]-5-imino-2-[(2-methylphenoxy)methyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cn(Cc3ccccc3)c3ccccc23)/C(=O)N=C2SC(COc3ccccc3C)=NN2/1 |
| InChI | InChI=1S/C29H23N5O2S/c1-19-9-5-8-14-25(19)36-18-26-32-34-27(30)23(28(35)31-29(34)37-26)15-21-17-33(16-20-10-3-2-4-11-20)24-13-7-6-12-22(21)24/h2-15,17,30H,16,18H2,1H3/b23-15-,30-27- |
| InChIKey | QCIBIOLRPZFBDS-KWSKTOGSSA-N |
| XLogP | 5.70 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|