C29H31N5OS — CID 6290088
(6E)-2-heptyl-5-imino-6-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 6290088) has the molecular formula C29H31N5OS and a molecular weight of 497.67 g/mol. Its IUPAC name is (6E)-2-heptyl-5-imino-6-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-2-heptyl-5-imino-6-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 6290088 |
| Molecular Formula | C29H31N5OS |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | (6E)-2-heptyl-5-imino-6-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cn(Cc3ccccc3C)c3ccccc23)/C(=O)N=C2SC(CCCCCCC)=NN2/1 |
| InChI | InChI=1S/C29H31N5OS/c1-3-4-5-6-7-16-26-32-34-27(30)24(28(35)31-29(34)36-26)17-22-19-33(25-15-11-10-14-23(22)25)18-21-13-9-8-12-20(21)2/h8-15,17,19,30H,3-7,16,18H2,1-2H3/b24-17+,30-27- |
| InChIKey | OUQMCKVRDQWVTJ-KMCQGPATSA-N |
| XLogP | 6.98 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|