C28H28FN5OS — CID 3778218
6-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3778218) has the molecular formula C28H28FN5OS and a molecular weight of 501.63 g/mol. Its IUPAC name is 6-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3778218 |
| Molecular Formula | C28H28FN5OS |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 6-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2cn(Cc3ccccc3F)c3ccccc23)C(=O)N=C2SC(CCCCCCC)=NN21 |
| InChI | InChI=1S/C28H28FN5OS/c1-2-3-4-5-6-15-25-32-34-26(30)22(27(35)31-28(34)36-25)16-20-18-33(24-14-10-8-12-21(20)24)17-19-11-7-9-13-23(19)29/h7-14,16,18,30H,2-6,15,17H2,1H3/b22-16?,30-26- |
| InChIKey | GYFTWHAFQUIOQY-WRNLAWCOSA-N |
| XLogP | 6.81 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|