C26H27FN4O2S — CID 56727892
(6Z)-6-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 56727892) has the molecular formula C26H27FN4O2S and a molecular weight of 478.59 g/mol. Its IUPAC name is (6Z)-6-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56727892 |
| Molecular Formula | C26H27FN4O2S |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (6Z)-6-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccc(OCc3ccccc3F)cc2)/C(=O)N=C2SC(CCCCCCC)=NN2/1 |
| InChI | InChI=1S/C26H27FN4O2S/c1-2-3-4-5-6-11-23-30-31-24(28)21(25(32)29-26(31)34-23)16-18-12-14-20(15-13-18)33-17-19-9-7-8-10-22(19)27/h7-10,12-16,28H,2-6,11,17H2,1H3/b21-16-,28-24- |
| InChIKey | UUXVVPLUAMZMEO-CPVRDGELSA-N |
| XLogP | 6.38 |
| TPSA | 78.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|