C19H21BrN4OS — CID 25251313
(6Z)-6-[(2-bromophenyl)methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 25251313) has the molecular formula C19H21BrN4OS and a molecular weight of 433.38 g/mol. Its IUPAC name is (6Z)-6-[(2-bromophenyl)methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[(2-bromophenyl)methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 25251313 |
| Molecular Formula | C19H21BrN4OS |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | (6Z)-6-[(2-bromophenyl)methylidene]-2-heptyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccccc2Br)/C(=O)N=C2SC(CCCCCCC)=NN2/1 |
| InChI | InChI=1S/C19H21BrN4OS/c1-2-3-4-5-6-11-16-23-24-17(21)14(18(25)22-19(24)26-16)12-13-9-7-8-10-15(13)20/h7-10,12,21H,2-6,11H2,1H3/b14-12-,21-17- |
| InChIKey | IHUGNZYRDWKPHS-SKZCFEMMSA-N |
| XLogP | 5.43 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|