C15H15BrN4O2S — CID 4271693
6-[(5-bromofuran-2-yl)methylidene]-5-imino-2-pentyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4271693) has the molecular formula C15H15BrN4O2S and a molecular weight of 395.28 g/mol. Its IUPAC name is 6-[(5-bromofuran-2-yl)methylidene]-5-imino-2-pentyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[(5-bromofuran-2-yl)methylidene]-5-imino-2-pentyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4271693 |
| Molecular Formula | C15H15BrN4O2S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 6-[(5-bromofuran-2-yl)methylidene]-5-imino-2-pentyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(Br)o2)C(=O)N=C2SC(CCCCC)=NN21 |
| InChI | InChI=1S/C15H15BrN4O2S/c1-2-3-4-5-12-19-20-13(17)10(14(21)18-15(20)23-12)8-9-6-7-11(16)22-9/h6-8,17H,2-5H2,1H3/b10-8?,17-13+ |
| InChIKey | OGMDANAAFSSIKH-URJXYEKSSA-N |
| XLogP | 4.24 |
| TPSA | 82.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|