C19H14BrN5O4S — CID 2892743
6-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-imino-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 2892743) has the molecular formula C19H14BrN5O4S and a molecular weight of 488.32 g/mol. Its IUPAC name is 6-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-imino-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-imino-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 2892743 |
| Molecular Formula | C19H14BrN5O4S |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | 6-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-imino-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(-c3ccc([N+](=O)[O-])cc3Br)o2)C(=O)N=C2SC(CCC)=NN21 |
| InChI | InChI=1S/C19H14BrN5O4S/c1-2-3-16-23-24-17(21)13(18(26)22-19(24)30-16)9-11-5-7-15(29-11)12-6-4-10(25(27)28)8-14(12)20/h4-9,21H,2-3H2,1H3/b13-9?,21-17+ |
| InChIKey | HJHCKDKYHNFMTQ-GCYRHHKDSA-N |
| XLogP | 5.04 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|