C20H17N5O5S — CID 5349755
(6Z)-5-imino-6-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 5349755) has the molecular formula C20H17N5O5S and a molecular weight of 439.45 g/mol. Its IUPAC name is (6Z)-5-imino-6-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-5-imino-6-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 5349755 |
| Molecular Formula | C20H17N5O5S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | (6Z)-5-imino-6-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccc(-c3ccc([N+](=O)[O-])cc3OC)o2)/C(=O)N=C2SC(C(C)C)=NN2/1 |
| InChI | InChI=1S/C20H17N5O5S/c1-10(2)19-23-24-17(21)14(18(26)22-20(24)31-19)9-12-5-7-15(30-12)13-6-4-11(25(27)28)8-16(13)29-3/h4-10,21H,1-3H3/b14-9-,21-17- |
| InChIKey | ANPFGPQMFDZZEU-MHQLMORGSA-N |
| XLogP | 4.14 |
| TPSA | 134.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|