C25H18BrN5O6S — CID 6534000
(6Z)-6-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2-[(3,4-dimethoxyphenyl)methyl]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 6534000) has the molecular formula C25H18BrN5O6S and a molecular weight of 596.42 g/mol. Its IUPAC name is (6Z)-6-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2-[(3,4-dimethoxyphenyl)methyl]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2-[(3,4-dimethoxyphenyl)methyl]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 6534000 |
| Molecular Formula | C25H18BrN5O6S |
| Molecular Weight | 596.42 g/mol |
| Exact Mass | 595.02 |
| IUPAC Name | (6Z)-6-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2-[(3,4-dimethoxyphenyl)methyl]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccc(-c3ccc([N+](=O)[O-])cc3Br)o2)/C(=O)N=C2SC(Cc3ccc(OC)c(OC)c3)=NN2/1 |
| InChI | InChI=1S/C25H18BrN5O6S/c1-35-20-7-3-13(9-21(20)36-2)10-22-29-30-23(27)17(24(32)28-25(30)38-22)12-15-5-8-19(37-15)16-6-4-14(31(33)34)11-18(16)26/h3-9,11-12,27H,10H2,1-2H3/b17-12-,27-23- |
| InChIKey | ASSGGXNBZVSOJQ-MYVYNBFBSA-N |
| XLogP | 5.50 |
| TPSA | 143.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.42 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|